CAS 17989-90-1 appears in our catalog under these names: Acrylic acid barium salt monomer, 95%, Barium acrylate, Barium Acrylate Monomer, >95.0%(T), Barium acrylate. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
Barium(2+);bis(prop-2-enoate) (CAS 17989-90-1) is a chemical compound with the molecular formula C6H6BaO4 and a molecular weight of 279.44 g/mol. IUPAC name: barium(2+);bis(prop-2-enoate). InChIKey: ONQPQIFFWHMGGE-UHFFFAOYSA-L.
| Molecular formula | C6H6BaO4 |
|---|---|
| Molecular weight | 279.44 g/mol |
| IUPAC name | barium(2+);bis(prop-2-enoate) |
| InChIKey | ONQPQIFFWHMGGE-UHFFFAOYSA-L |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].[Ba+2] |
Computed by PubChem (NCBI)