Products 179914-06-8
CAS 179914-06-8 appears in our catalog under these names: (R)-1-(4-Bromophenyl)ethane-1,2-diol, 98%, 98%, (R)-1-(4-Bromophenyl)ethane-1,2-diol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-bromophenyl)ethane-1,2-diol (CAS 179914-06-8) is a chemical compound with the molecular formula C8H9BrO2 and a molecular weight of 217.06 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)ethane-1,2-diol. InChIKey: ZDPJGAWPRHNQHI-QMMMGPOBSA-N.
| Molecular formula | C8H9BrO2 |
|---|---|
| Molecular weight | 217.06 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)ethane-1,2-diol |
| InChIKey | ZDPJGAWPRHNQHI-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)O)Br |
Computed by PubChem (NCBI)