CAS 17994-15-9 appears in our catalog under these names: Sempervirine Nitrate, Sempervirine (nitrate). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
16,17,18,19-tetrahydro-3H-yohimban-13-ium nitrate (CAS 17994-15-9) is a chemical compound with the molecular formula C19H17N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: 16,17,18,19-tetrahydro-3H-yohimban-13-ium nitrate. InChIKey: NPMOCMWCFIQGMK-UHFFFAOYSA-O.
| Molecular formula | C19H17N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 16,17,18,19-tetrahydro-3H-yohimban-13-ium nitrate |
| InChIKey | NPMOCMWCFIQGMK-UHFFFAOYSA-O |
| SMILES | C1CCC2=C[N+]3=C(C=C2C1)C4=C(C=C3)C5=CC=CC=C5N4.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)