CAS 1799401-52-7 is the registry number for 1,2-Bis(dicyclopentylphosphonium)ethane bis(tetrafluoroborate), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dicyclopentyl(2-dicyclopentylphosphaniumylethyl)phosphanium ditetrafluoroborate (CAS 1799401-52-7) is a chemical compound with the molecular formula C22H42B2F8P2 and a molecular weight of 542.1 g/mol. IUPAC name: dicyclopentyl(2-dicyclopentylphosphaniumylethyl)phosphanium ditetrafluoroborate. InChIKey: OCAXMXBMZLDGLW-UHFFFAOYSA-P.
| Molecular formula | C22H42B2F8P2 |
|---|---|
| Molecular weight | 542.1 g/mol |
| IUPAC name | dicyclopentyl(2-dicyclopentylphosphaniumylethyl)phosphanium ditetrafluoroborate |
| InChIKey | OCAXMXBMZLDGLW-UHFFFAOYSA-P |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(C1)[PH+](CC[PH+](C2CCCC2)C3CCCC3)C4CCCC4 |
Computed by PubChem (NCBI)