CAS 1799421-05-8 appears in our catalog under these names: 4-Chloro-5-fluoro-2-methylquinoline, 95+%, 4-Chloro-5-fluoro-2-methylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 50mg, 0,5g.
4-chloro-5-fluoro-2-methylquinoline (CAS 1799421-05-8) is a chemical compound with the molecular formula C10H7ClFN and a molecular weight of 195.62 g/mol. IUPAC name: 4-chloro-5-fluoro-2-methylquinoline. InChIKey: HHVYZSVUZFRSLH-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFN |
|---|---|
| Molecular weight | 195.62 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-methylquinoline |
| InChIKey | HHVYZSVUZFRSLH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=N1)C=CC=C2F)Cl |
Computed by PubChem (NCBI)