CAS 1799421-06-9 is the registry number for 3-Amino-2,6-diethylbenzonitrile. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
3-amino-2,6-diethylbenzonitrile (CAS 1799421-06-9) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 3-amino-2,6-diethylbenzonitrile. InChIKey: JEFFGMAVJYVXST-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 3-amino-2,6-diethylbenzonitrile |
| InChIKey | JEFFGMAVJYVXST-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)N)CC)C#N |
Computed by PubChem (NCBI)