CAS 1799610-91-5 is the registry number for 4-CHLORO-5,6-DIIODOTHIENO[2,3-D]PYRIMIDINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-5,6-diiodothieno[2,3-d]pyrimidine (CAS 1799610-91-5) is a chemical compound with the molecular formula C6HClI2N2S and a molecular weight of 422.41 g/mol. IUPAC name: 4-chloro-5,6-diiodothieno[2,3-d]pyrimidine. InChIKey: MQEJJHPRNBGTMM-UHFFFAOYSA-N.
| Molecular formula | C6HClI2N2S |
|---|---|
| Molecular weight | 422.41 g/mol |
| IUPAC name | 4-chloro-5,6-diiodothieno[2,3-d]pyrimidine |
| InChIKey | MQEJJHPRNBGTMM-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=C(S2)I)I)C(=N1)Cl |
Computed by PubChem (NCBI)