Products 1799626-16-6
CAS 1799626-16-6 is the registry number for EP2 receptor antagonist-3, 99.08%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 10 mg, 100 mg, 25 mg.
4-[[9-chloro-7-(5-fluoroindol-1-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-1H-pyridin-2-one (CAS 1799626-16-6) is a chemical compound with the molecular formula C23H19ClFN3O2 and a molecular weight of 423.9 g/mol. IUPAC name: 4-[[9-chloro-7-(5-fluoroindol-1-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-1H-pyridin-2-one. InChIKey: JCMBXRJQNVPHIQ-UHFFFAOYSA-N.
| Molecular formula | C23H19ClFN3O2 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | 4-[[9-chloro-7-(5-fluoroindol-1-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-1H-pyridin-2-one |
| InChIKey | JCMBXRJQNVPHIQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1CC3=CC(=O)NC=C3)C=C(C=C2Cl)N4C=CC5=C4C=CC(=C5)F |
Computed by PubChem (NCBI)
Synonyms:
Amgen Compound 52, orb3136344