CAS 1799753-84-6 appears in our catalog under these names: BAY-876, >95% (HPLC), BAY-876/ 98.61% (existing batch purity), BAY–876, BAY-876 98%, BAY-876, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
4-N-[1-[(4-cyanophenyl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-fluoroquinoline-2,4-dicarboxamide (CAS 1799753-84-6) is a chemical compound with the molecular formula C24H16F4N6O2 and a molecular weight of 496.4 g/mol. IUPAC name: 4-N-[1-[(4-cyanophenyl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-fluoroquinoline-2,4-dicarboxamide. InChIKey: BKLJDIJJOOQUFG-UHFFFAOYSA-N.
| Molecular formula | C24H16F4N6O2 |
|---|---|
| Molecular weight | 496.4 g/mol |
| IUPAC name | 4-N-[1-[(4-cyanophenyl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-fluoroquinoline-2,4-dicarboxamide |
| InChIKey | BKLJDIJJOOQUFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)C#N)C(F)(F)F)NC(=O)C3=CC(=NC4=C3C=CC(=C4)F)C(=O)N |
Computed by PubChem (NCBI)