Products 1799769-18-8
CAS 1799769-18-8 is the registry number for 4-Aminobutyl β-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg.
(2R,3R,4S,5R,6R)-2-(4-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 1799769-18-8) is a chemical compound with the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-(4-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: WYKYJLAXVJZRIC-SOYHJAILSA-N.
| Molecular formula | C10H21NO6 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-(4-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | WYKYJLAXVJZRIC-SOYHJAILSA-N |
| SMILES | C(CCO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)CN |
Computed by PubChem (NCBI)