CAS 17998-59-3 is the registry number for (1–NAPHTHYLMETHYL)TRICHLOROSILANE. Offered by: GLPBio. Available pack sizes: 10g.
Trichloro(naphthalen-1-ylmethyl)silane (CAS 17998-59-3) is a chemical compound with the molecular formula C11H9Cl3Si and a molecular weight of 275.6 g/mol. IUPAC name: trichloro(naphthalen-1-ylmethyl)silane. InChIKey: ZTCCIXDZFGSHTQ-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl3Si |
|---|---|
| Molecular weight | 275.6 g/mol |
| IUPAC name | trichloro(naphthalen-1-ylmethyl)silane |
| InChIKey | ZTCCIXDZFGSHTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)