CAS 1800100-71-3 is the registry number for (2S)-1-Diisopropoxyphosphoryl-2-methylaziridine. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
(2S)-1-di(propan-2-yloxy)phosphoryl-2-methylaziridine (CAS 1800100-71-3) is a chemical compound with the molecular formula C9H20NO3P and a molecular weight of 221.23 g/mol. IUPAC name: (2S)-1-di(propan-2-yloxy)phosphoryl-2-methylaziridine. InChIKey: MALAZZMAEHYRBE-RGURZIINSA-N.
| Molecular formula | C9H20NO3P |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | (2S)-1-di(propan-2-yloxy)phosphoryl-2-methylaziridine |
| InChIKey | MALAZZMAEHYRBE-RGURZIINSA-N |
| SMILES | C[C@H]1CN1P(=O)(OC(C)C)OC(C)C |
Computed by PubChem (NCBI)