CAS 1800247-11-3 is the registry number for N-((2,4-Difluorophenyl)methyl)-1,4-dihydro-5-hydroxy-4-oxo-3-pyridinecarboxamide. Offered by: TRC. Available pack sizes: 50mg.
N-[(2,4-difluorophenyl)methyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboxamide (CAS 1800247-11-3) is a chemical compound with the molecular formula C13H10F2N2O3 and a molecular weight of 280.23 g/mol. IUPAC name: N-[(2,4-difluorophenyl)methyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboxamide. InChIKey: CKPPYTYTWPIIPT-UHFFFAOYSA-N.
| Molecular formula | C13H10F2N2O3 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | N-[(2,4-difluorophenyl)methyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboxamide |
| InChIKey | CKPPYTYTWPIIPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CNC(=O)C2=CNC=C(C2=O)O |
Computed by PubChem (NCBI)