Products 1800261-02-2
CAS 1800261-02-2 is the registry number for 5-bromo-1-chloro-3-fluoro-2-isobutoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-chloro-3-fluoro-2-(2-methylpropoxy)benzene (CAS 1800261-02-2) is a chemical compound with the molecular formula C10H11BrClFO and a molecular weight of 281.55 g/mol. IUPAC name: 5-bromo-1-chloro-3-fluoro-2-(2-methylpropoxy)benzene. InChIKey: ITUMEIDQHIIPRP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClFO |
|---|---|
| Molecular weight | 281.55 g/mol |
| IUPAC name | 5-bromo-1-chloro-3-fluoro-2-(2-methylpropoxy)benzene |
| InChIKey | ITUMEIDQHIIPRP-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1Cl)Br)F |
Computed by PubChem (NCBI)