CAS 180044-55-7 appears in our catalog under these names: {[(2-fluorophenyl)methyl]sulfanyl}acetic acid, 95%, 2-((2-Fluorobenzyl)thio)acetic acid 97%, {[(2-fluorophenyl)methyl]sulfanyl}acetic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-[(2-fluorophenyl)methylsulfanyl]acetic acid (CAS 180044-55-7) is a chemical compound with the molecular formula C9H9FO2S and a molecular weight of 200.23 g/mol. IUPAC name: 2-[(2-fluorophenyl)methylsulfanyl]acetic acid. InChIKey: WYYYOCFFKHMWML-UHFFFAOYSA-N.
| Molecular formula | C9H9FO2S |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)methylsulfanyl]acetic acid |
| InChIKey | WYYYOCFFKHMWML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSCC(=O)O)F |
Computed by PubChem (NCBI)