CAS 1800507-93-0 appears in our catalog under these names: (E)-Cyclooct-4-en-1-yl (2-(2-(2-(2-aminoethoxy)ethoxy)ethoxy)ethyl)carbamate, 98%, TCO–PEG3–amine, TCO-PEG3-amine 95%, TCO-PEG3-amine, 98%, 98%, TCO-PEG3-amine, 96.49%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 25mg, 250mg, 10mg, 50mg, 25 mg, 5 mg.
[(4Z)-cyclooct-4-en-1-yl] N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate (CAS 1800507-93-0) is a chemical compound with the molecular formula C17H32N2O5 and a molecular weight of 344.4 g/mol. IUPAC name: [(4Z)-cyclooct-4-en-1-yl] N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate. InChIKey: AFIOVAPNQNBQKL-UPHRSURJSA-N.
| Molecular formula | C17H32N2O5 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [(4Z)-cyclooct-4-en-1-yl] N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | AFIOVAPNQNBQKL-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)NCCOCCOCCOCCN |
Computed by PubChem (NCBI)