Products 1800579-12-7
CAS 1800579-12-7 is the registry number for rac-(2R,6S)-2,6-Dimethyl-4-(prop-2-yn-1-yl)morpholine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2R,6S)-2,6-dimethyl-4-prop-2-ynylmorpholine (CAS 1800579-12-7) is a chemical compound with the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. IUPAC name: (2R,6S)-2,6-dimethyl-4-prop-2-ynylmorpholine. InChIKey: MIZZHIJHLUWAGH-DTORHVGOSA-N.
| Molecular formula | C9H15NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethyl-4-prop-2-ynylmorpholine |
| InChIKey | MIZZHIJHLUWAGH-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC#C |
Computed by PubChem (NCBI)