CAS 180079-59-8 is the registry number for Tert–butyl (1–(3–aminophenyl)ethyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl N-[1-(3-aminophenyl)ethyl]carbamate (CAS 180079-59-8) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl N-[1-(3-aminophenyl)ethyl]carbamate. InChIKey: QZEKBDHFLADZKW-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tert-butyl N-[1-(3-aminophenyl)ethyl]carbamate |
| InChIKey | QZEKBDHFLADZKW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)