Products 180079-59-8

CAS 180079-59-8 is the registry number for Tert–butyl (1–(3–aminophenyl)ethyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(3-aminophenyl)ethyl]carbamate (CAS 180079-59-8) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl N-[1-(3-aminophenyl)ethyl]carbamate. InChIKey: QZEKBDHFLADZKW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O2
Molecular weight236.31 g/mol
IUPAC nametert-butyl N-[1-(3-aminophenyl)ethyl]carbamate
InChIKeyQZEKBDHFLADZKW-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC=C1)N)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)