Products 1801151-15-4
CAS 1801151-15-4 is the registry number for BMT-108908. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-1-[(4-fluorophenyl)methyl]-3-[4-(4-hydroxyphenyl)piperidin-1-yl]pyrrolidin-2-one (CAS 1801151-15-4) is a chemical compound with the molecular formula C22H25FN2O2 and a molecular weight of 368.4 g/mol. IUPAC name: (3R)-1-[(4-fluorophenyl)methyl]-3-[4-(4-hydroxyphenyl)piperidin-1-yl]pyrrolidin-2-one. InChIKey: KOQYBHVHTCKDIZ-OAQYLSRUSA-N.
| Molecular formula | C22H25FN2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (3R)-1-[(4-fluorophenyl)methyl]-3-[4-(4-hydroxyphenyl)piperidin-1-yl]pyrrolidin-2-one |
| InChIKey | KOQYBHVHTCKDIZ-OAQYLSRUSA-N |
| SMILES | C1CN(C(=O)[C@@H]1N2CCC(CC2)C3=CC=C(C=C3)O)CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)