CAS 1801188-14-6 is the registry number for 2-Iodobenzimidamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodobenzenecarboximidamide;hydrochloride (CAS 1801188-14-6) is a chemical compound with the molecular formula C7H8ClIN2 and a molecular weight of 282.51 g/mol. IUPAC name: 2-iodobenzenecarboximidamide;hydrochloride. InChIKey: ORKLYOXFPWTZAZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClIN2 |
|---|---|
| Molecular weight | 282.51 g/mol |
| IUPAC name | 2-iodobenzenecarboximidamide;hydrochloride |
| InChIKey | ORKLYOXFPWTZAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=N)N)I.Cl |
Computed by PubChem (NCBI)