CAS 1801257-56-6 is the registry number for 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)imidazolidin-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidin-2-one (CAS 1801257-56-6) is a chemical compound with the molecular formula C16H23BN2O3 and a molecular weight of 302.2 g/mol. IUPAC name: 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidin-2-one. InChIKey: BCMRNWXQUAJVGZ-UHFFFAOYSA-N.
| Molecular formula | C16H23BN2O3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidin-2-one |
| InChIKey | BCMRNWXQUAJVGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCNC3=O |
Computed by PubChem (NCBI)