Products 1801260-45-6
CAS 1801260-45-6 is the registry number for Clopidogrel Thiol Metabolite H4 Isomer. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-2-[(4R)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid;formic acid (CAS 1801260-45-6) is a chemical compound with the molecular formula C17H20ClNO6S and a molecular weight of 401.9 g/mol. IUPAC name: (2Z)-2-[(4R)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid;formic acid. InChIKey: AOUKYPYYXKEPKI-CBIDAWJSSA-N.
| Molecular formula | C17H20ClNO6S |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | (2Z)-2-[(4R)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid;formic acid |
| InChIKey | AOUKYPYYXKEPKI-CBIDAWJSSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CC[C@H](/C(=C\C(=O)O)/C2)S.C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Clopidogrel Impurity 116