Products 1801408-19-4

CAS 1801408-19-4 is the registry number for 5-Hydroxypyridine-3-boronic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-hydroxy-3-pyridinyl)boronic acid;hydrochloride (CAS 1801408-19-4) is a chemical compound with the molecular formula C5H7BClNO3 and a molecular weight of 175.38 g/mol. IUPAC name: (5-hydroxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: ZYFJPPVDJOYVCM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7BClNO3
Molecular weight175.38 g/mol
IUPAC name(5-hydroxy-3-pyridinyl)boronic acid;hydrochloride
InChIKeyZYFJPPVDJOYVCM-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1)O)(O)O.Cl

Computed by PubChem (NCBI)