CAS 1801691-99-5 appears in our catalog under these names: N-(2,4-Dimethylphenyl)formamide-d9, >95% (HPLC), N-(2,4-Dimethylphenyl)formamide-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
N-[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]formamide (CAS 1801691-99-5) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 158.24 g/mol. IUPAC name: N-[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]formamide. InChIKey: JOFDPSBOUCXJCC-XVGWXEQOSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | N-[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]formamide |
| InChIKey | JOFDPSBOUCXJCC-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])NC=O)[2H] |
Computed by PubChem (NCBI)