Products 1801767-24-7
CAS 1801767-24-7 is the registry number for (3R,4S)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine (CAS 1801767-24-7) is a chemical compound with the molecular formula C9H18N2O and a molecular weight of 170.25 g/mol. IUPAC name: (3R,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine. InChIKey: QORIMRSQLRAMSF-HTQZYQBOSA-N.
| Molecular formula | C9H18N2O |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (3R,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
| InChIKey | QORIMRSQLRAMSF-HTQZYQBOSA-N |
| SMILES | C[C@@H]1[C@H](C2(CCNCC2)CO1)N |
Computed by PubChem (NCBI)