CAS 1801893-44-6 appears in our catalog under these names: 2-(2,2-Dimethylpropanamido)-4-methylpentanoic acid, 98%, Pivaloylleucine, 97%, 2-(2,2-dimethylpropanamido)-4-methylpentanoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 100g.
2-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid (CAS 1801893-44-6) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid. InChIKey: OLZMLDKOPZADGZ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid |
| InChIKey | OLZMLDKOPZADGZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)