CAS 1801906-12-6 is the registry number for 5-Bromo-2,4-dimethyl-3-nitropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2,4-dimethyl-3-nitropyridine (CAS 1801906-12-6) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 5-bromo-2,4-dimethyl-3-nitropyridine. InChIKey: FEJYHXKMEDXPBE-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 5-bromo-2,4-dimethyl-3-nitropyridine |
| InChIKey | FEJYHXKMEDXPBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)