CAS 1802068-51-4 is the registry number for UNI418, 99.61%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 10mM/1mL, 50 mg, 5 mg.
N-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine (CAS 1802068-51-4) is a chemical compound with the molecular formula C22H16N6 and a molecular weight of 364.4 g/mol. IUPAC name: N-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine. InChIKey: OMNOGBPVYFVKRM-UHFFFAOYSA-N.
| Molecular formula | C22H16N6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | N-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine |
| InChIKey | OMNOGBPVYFVKRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2)NC3=NC(=NC4=CC=CC=C43)C5=CC=NC=C5 |
Computed by PubChem (NCBI)