Products 1802068-51-4

CAS 1802068-51-4 is the registry number for UNI418, 99.61%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 10mM/1mL, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine (CAS 1802068-51-4) is a chemical compound with the molecular formula C22H16N6 and a molecular weight of 364.4 g/mol. IUPAC name: N-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine. InChIKey: OMNOGBPVYFVKRM-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16N6
Molecular weight364.4 g/mol
IUPAC nameN-(5-phenyl-1H-pyrazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine
InChIKeyOMNOGBPVYFVKRM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=NN2)NC3=NC(=NC4=CC=CC=C43)C5=CC=NC=C5

Computed by PubChem (NCBI)