Products 1802151-33-2
CAS 1802151-33-2 is the registry number for (S)-1-(2-Chloropyrimidin-5-yl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2-chloropyrimidin-5-yl)ethanol (CAS 1802151-33-2) is a chemical compound with the molecular formula C6H7ClN2O and a molecular weight of 158.58 g/mol. IUPAC name: (1S)-1-(2-chloropyrimidin-5-yl)ethanol. InChIKey: FOCGRSGPIGTELP-BYPYZUCNSA-N.
| Molecular formula | C6H7ClN2O |
|---|---|
| Molecular weight | 158.58 g/mol |
| IUPAC name | (1S)-1-(2-chloropyrimidin-5-yl)ethanol |
| InChIKey | FOCGRSGPIGTELP-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=CN=C(N=C1)Cl)O |
Computed by PubChem (NCBI)