Products 1802370-70-2
CAS 1802370-70-2 is the registry number for 4-(N-Boc-Pyrrolidin-3-yl)phenylboronic acid pinacol ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxylate (CAS 1802370-70-2) is a chemical compound with the molecular formula C21H32BNO4 and a molecular weight of 373.3 g/mol. IUPAC name: tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxylate. InChIKey: XAYALASJHAIXCO-UHFFFAOYSA-N.
| Molecular formula | C21H32BNO4 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxylate |
| InChIKey | XAYALASJHAIXCO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)