CAS 1802430-56-3 appears in our catalog under these names: (6-Amino-3-chloro-2-fluorophenyl)boronic acid, 98%, 98%, (6-AMINO-3-CHLORO-2-FLUORO-PHENYL)BORONIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(6-amino-3-chloro-2-fluorophenyl)boronic acid (CAS 1802430-56-3) is a chemical compound with the molecular formula C6H6BClFNO2 and a molecular weight of 189.38 g/mol. IUPAC name: (6-amino-3-chloro-2-fluorophenyl)boronic acid. InChIKey: DFVBNYAMTHHWMF-UHFFFAOYSA-N.
| Molecular formula | C6H6BClFNO2 |
|---|---|
| Molecular weight | 189.38 g/mol |
| IUPAC name | (6-amino-3-chloro-2-fluorophenyl)boronic acid |
| InChIKey | DFVBNYAMTHHWMF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Cl)N)(O)O |
Computed by PubChem (NCBI)