CAS 180260-72-4 is the registry number for 2-Azido-2,3-dihydro-1h-indene. Offered by: TRC. Available pack sizes: 2,5g.
2-azido-2,3-dihydro-1H-indene (CAS 180260-72-4) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 2-azido-2,3-dihydro-1H-indene. InChIKey: JBTWHOQSNDVASP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 2-azido-2,3-dihydro-1H-indene |
| InChIKey | JBTWHOQSNDVASP-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)N=[N+]=[N-] |
Computed by PubChem (NCBI)