CAS 1802661-73-9 appears in our catalog under these names: ONO-8590580, 98%, ONO-8590580/ 99.54% (existing batch purity), ONO–8590580, ONO-8590580, ONO-8590580, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
3-(cyclopropylmethyl)-6-fluoro-7-methyl-N-[5-(1-methylimidazol-4-yl)-2-pyridinyl]benzimidazol-5-amine (CAS 1802661-73-9) is a chemical compound with the molecular formula C21H21FN6 and a molecular weight of 376.4 g/mol. IUPAC name: 3-(cyclopropylmethyl)-6-fluoro-7-methyl-N-[5-(1-methylimidazol-4-yl)-2-pyridinyl]benzimidazol-5-amine. InChIKey: INGJMHPGMVUEKY-UHFFFAOYSA-N.
| Molecular formula | C21H21FN6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 3-(cyclopropylmethyl)-6-fluoro-7-methyl-N-[5-(1-methylimidazol-4-yl)-2-pyridinyl]benzimidazol-5-amine |
| InChIKey | INGJMHPGMVUEKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC2=C1N=CN2CC3CC3)NC4=NC=C(C=C4)C5=CN(C=N5)C)F |
Computed by PubChem (NCBI)