Products 1802703-20-3
CAS 1802703-20-3 is the registry number for AAK1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1R)-1-amino-3-methylbutyl]-6-pyridin-4-ylquinoline-4-carbonitrile (CAS 1802703-20-3) is a chemical compound with the molecular formula C20H20N4 and a molecular weight of 316.4 g/mol. IUPAC name: 2-[(1R)-1-amino-3-methylbutyl]-6-pyridin-4-ylquinoline-4-carbonitrile. InChIKey: FMNWOBLAZAYOSG-GOSISDBHSA-N.
| Molecular formula | C20H20N4 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-[(1R)-1-amino-3-methylbutyl]-6-pyridin-4-ylquinoline-4-carbonitrile |
| InChIKey | FMNWOBLAZAYOSG-GOSISDBHSA-N |
| SMILES | CC(C)C[C@H](C1=NC2=C(C=C(C=C2)C3=CC=NC=C3)C(=C1)C#N)N |
Computed by PubChem (NCBI)