CAS 1802735-28-9 is the registry number for QBS10072S. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]butanoic acid (CAS 1802735-28-9) is a chemical compound with the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.2 g/mol. IUPAC name: (3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]butanoic acid. InChIKey: CWYYHMPCMCTGFA-ZDUSSCGKSA-N.
| Molecular formula | C15H22Cl2N2O2 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | (3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]butanoic acid |
| InChIKey | CWYYHMPCMCTGFA-ZDUSSCGKSA-N |
| SMILES | CC1=C(C=C(C=C1)N(CCCl)CCCl)C[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)