CAS 1802770-18-8 is the registry number for VMD-928. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10 mg, 50 mg, 25 mg.
4-[[4-amino-3-(4-cyclohexylpiperazin-1-yl)-9,10-dioxoanthracen-1-yl]amino]benzoic acid (CAS 1802770-18-8) is a chemical compound with the molecular formula C31H32N4O4 and a molecular weight of 524.6 g/mol. IUPAC name: 4-[[4-amino-3-(4-cyclohexylpiperazin-1-yl)-9,10-dioxoanthracen-1-yl]amino]benzoic acid. InChIKey: YLGUWQFLCMWHDK-UHFFFAOYSA-N.
| Molecular formula | C31H32N4O4 |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | 4-[[4-amino-3-(4-cyclohexylpiperazin-1-yl)-9,10-dioxoanthracen-1-yl]amino]benzoic acid |
| InChIKey | YLGUWQFLCMWHDK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2CCN(CC2)C3=C(C4=C(C(=C3)NC5=CC=C(C=C5)C(=O)O)C(=O)C6=CC=CC=C6C4=O)N |
Computed by PubChem (NCBI)