CAS 1802818-85-4 is the registry number for Rel-(4-chlorophenyl)((1R,2R)-2-(trifluoromethyl)cyclopropyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methanone (CAS 1802818-85-4) is a chemical compound with the molecular formula C11H8ClF3O and a molecular weight of 248.63 g/mol. IUPAC name: (4-chlorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methanone. InChIKey: MBBPOBNUXJCEDC-RKDXNWHRSA-N.
| Molecular formula | C11H8ClF3O |
|---|---|
| Molecular weight | 248.63 g/mol |
| IUPAC name | (4-chlorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methanone |
| InChIKey | MBBPOBNUXJCEDC-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)