CAS 1802907-98-7 appears in our catalog under these names: Pc alkyne-peg4-nhs carbonate ester, 95%, PC Alkyne-PEG4-NHS ester, PC Alkyne–PEG4–NHS ester, Pc alkyne-PEG4-NHS carbonate ester, Pc alkyne-peg4-nhs carbonate ester 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 2mg, 50mg, 250mg, 1g, 100 mg, 250 mg, 50 mg.
(2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]butoxy]phenyl]ethyl carbonate (CAS 1802907-98-7) is a chemical compound with the molecular formula C29H39N3O14 and a molecular weight of 653.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]butoxy]phenyl]ethyl carbonate. InChIKey: AOWMPLACVFKCJJ-UHFFFAOYSA-N.
| Molecular formula | C29H39N3O14 |
|---|---|
| Molecular weight | 653.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]butoxy]phenyl]ethyl carbonate |
| InChIKey | AOWMPLACVFKCJJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)NCCOCCOCCOCCOCC#C)OC)OC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)