CAS 1802997-81-4 appears in our catalog under these names: Ethyl (S)-1-(3-(4-chlorophenoxy)-2-hydroxypropyl)-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate, SEC, 98%, SEC, SEC, 98.26%. Offered by: Biosynth, AmBeed, GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
Ethyl 1-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-(4-methoxyphenyl)pyrazole-5-carboxylate (CAS 1802997-81-4) is a chemical compound with the molecular formula C22H23ClN2O5 and a molecular weight of 430.9 g/mol. IUPAC name: ethyl 1-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-(4-methoxyphenyl)pyrazole-5-carboxylate. InChIKey: OFKGGSVHXHMDDN-KRWDZBQOSA-N.
| Molecular formula | C22H23ClN2O5 |
|---|---|
| Molecular weight | 430.9 g/mol |
| IUPAC name | ethyl 1-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-(4-methoxyphenyl)pyrazole-5-carboxylate |
| InChIKey | OFKGGSVHXHMDDN-KRWDZBQOSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C[C@@H](COC2=CC=C(C=C2)Cl)O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)