CAS 1802999-98-9 appears in our catalog under these names: 3-Imino-n1,n1,n2,n2-tetraisopropylcycloprop-1-ene-1,2-diamine, 95%, 3-Imino-N1,N1,N2,N2-tetraisopropylcycloprop-1-ene-1,2-diamine, 97% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-imino-1-N,1-N,2-N,2-N-tetra(propan-2-yl)cyclopropene-1,2-diamine (CAS 1802999-98-9) is a chemical compound with the molecular formula C15H29N3 and a molecular weight of 251.41 g/mol. IUPAC name: 3-imino-1-N,1-N,2-N,2-N-tetra(propan-2-yl)cyclopropene-1,2-diamine. InChIKey: WPONFPKTLIYYFJ-UHFFFAOYSA-N.
| Molecular formula | C15H29N3 |
|---|---|
| Molecular weight | 251.41 g/mol |
| IUPAC name | 3-imino-1-N,1-N,2-N,2-N-tetra(propan-2-yl)cyclopropene-1,2-diamine |
| InChIKey | WPONFPKTLIYYFJ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=C(C1=N)N(C(C)C)C(C)C)C(C)C |
Computed by PubChem (NCBI)