CAS 1803-25-4 is the registry number for 2,4-Dichloro-9H-fluoren-9-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichlorofluoren-9-one (CAS 1803-25-4) is a chemical compound with the molecular formula C13H6Cl2O and a molecular weight of 249.09 g/mol. IUPAC name: 2,4-dichlorofluoren-9-one. InChIKey: MIBTVQKTXMCJAB-UHFFFAOYSA-N.
| Molecular formula | C13H6Cl2O |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2,4-dichlorofluoren-9-one |
| InChIKey | MIBTVQKTXMCJAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3Cl)Cl |
Computed by PubChem (NCBI)