Products 1803252-79-0
CAS 1803252-79-0 appears in our catalog under these names: Myristoleyl carnitine–d3, Myristoleyl carnitine-d3, 99.93%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 10 mg, 5 mg.
(3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-[(E)-tetradec-9-enoyl]oxybutanoate (CAS 1803252-79-0) is a chemical compound with the molecular formula C21H39NO4 and a molecular weight of 372.6 g/mol. IUPAC name: (3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-[(E)-tetradec-9-enoyl]oxybutanoate. InChIKey: ABVVZYXTZLEOHP-CNUZVPAMSA-N.
| Molecular formula | C21H39NO4 |
|---|---|
| Molecular weight | 372.6 g/mol |
| IUPAC name | (3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-[(E)-tetradec-9-enoyl]oxybutanoate |
| InChIKey | ABVVZYXTZLEOHP-CNUZVPAMSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCCCCCC/C=C/CCCC |
Computed by PubChem (NCBI)
Synonyms:
Myristoleyl carnitine-d3