CAS 1803357-22-3 appears in our catalog under these names: PDE12–IN–3, PDE12-IN-3, 99+%, PDE12-IN-3, 98.02%, PDE12-IN-3, 99.43%, 99.43%. Offered by: GLPBio, AmBeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mM (in 1ml dmso), 100mg, 10mM/1mL, 50 mg, 25 mg, 10 mg, 100 mg.
3-[6-[3-(hydroxymethyl)-2-phenylmorpholine-4-carbonyl]-1-methylbenzimidazol-2-yl]-1H-indole-6-carbonitrile (CAS 1803357-22-3) is a chemical compound with the molecular formula C29H25N5O3 and a molecular weight of 491.5 g/mol. IUPAC name: 3-[6-[3-(hydroxymethyl)-2-phenylmorpholine-4-carbonyl]-1-methylbenzimidazol-2-yl]-1H-indole-6-carbonitrile. InChIKey: BFUYKHPXWBXKQQ-UHFFFAOYSA-N.
| Molecular formula | C29H25N5O3 |
|---|---|
| Molecular weight | 491.5 g/mol |
| IUPAC name | 3-[6-[3-(hydroxymethyl)-2-phenylmorpholine-4-carbonyl]-1-methylbenzimidazol-2-yl]-1H-indole-6-carbonitrile |
| InChIKey | BFUYKHPXWBXKQQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)N3CCOC(C3CO)C4=CC=CC=C4)N=C1C5=CNC6=C5C=CC(=C6)C#N |
Computed by PubChem (NCBI)