CAS 1803561-85-4 is the registry number for 5-(4-Hydroxypiperidin-1-yl)-2-(piperidin-3-yl)-2,3-dihydropyridazin-3-one, carbonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Carbonic acid;5-(4-hydroxypiperidin-1-yl)-2-piperidin-3-ylpyridazin-3-one (CAS 1803561-85-4) is a chemical compound with the molecular formula C15H24N4O5 and a molecular weight of 340.37 g/mol. IUPAC name: carbonic acid;5-(4-hydroxypiperidin-1-yl)-2-piperidin-3-ylpyridazin-3-one. InChIKey: RLZLDBVPHFCZIY-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O5 |
|---|---|
| Molecular weight | 340.37 g/mol |
| IUPAC name | carbonic acid;5-(4-hydroxypiperidin-1-yl)-2-piperidin-3-ylpyridazin-3-one |
| InChIKey | RLZLDBVPHFCZIY-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)N2C(=O)C=C(C=N2)N3CCC(CC3)O.C(=O)(O)O |
Computed by PubChem (NCBI)