CAS 1803565-61-8 appears in our catalog under these names: 4-tert-Butyl-2-methyl-1,3-thiazole-5-sulfonamide, 95%, 4-tert-Butyl-2-methyl-1,3-thiazole-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide (CAS 1803565-61-8) is a chemical compound with the molecular formula C8H14N2O2S2 and a molecular weight of 234.3 g/mol. IUPAC name: 4-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide. InChIKey: NZDDLDNSGUWNRF-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O2S2 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 4-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide |
| InChIKey | NZDDLDNSGUWNRF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)S(=O)(=O)N)C(C)(C)C |
Computed by PubChem (NCBI)