CAS 1803565-87-8 appears in our catalog under these names: 4-Methyl-5-(trifluoromethyl)-4H-1,2,4-triazole-3-sulfonyl fluoride, 95%, 4-Methyl-5-(trifluoromethyl)-4H-1,2,4-triazole-3-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonyl fluoride (CAS 1803565-87-8) is a chemical compound with the molecular formula C4H3F4N3O2S and a molecular weight of 233.15 g/mol. IUPAC name: 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonyl fluoride. InChIKey: MMBYGWZHTYRMDG-UHFFFAOYSA-N.
| Molecular formula | C4H3F4N3O2S |
|---|---|
| Molecular weight | 233.15 g/mol |
| IUPAC name | 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonyl fluoride |
| InChIKey | MMBYGWZHTYRMDG-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1S(=O)(=O)F)C(F)(F)F |
Computed by PubChem (NCBI)