Products 1803566-89-3

CAS 1803566-89-3 is the registry number for Methyl 2,3-dibromoimidazo(1,2-a)pyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate (CAS 1803566-89-3) is a chemical compound with the molecular formula C9H6Br2N2O2 and a molecular weight of 333.96 g/mol. IUPAC name: methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate. InChIKey: BLSVWRKNCDRNCC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Br2N2O2
Molecular weight333.96 g/mol
IUPAC namemethyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate
InChIKeyBLSVWRKNCDRNCC-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN2C(=NC(=C2Br)Br)C=C1

Computed by PubChem (NCBI)