CAS 1803570-20-8 is the registry number for Cyclohexyl(3-(trifluoromethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cyclohexyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 1803570-20-8) is a chemical compound with the molecular formula C14H19ClF3N and a molecular weight of 293.75 g/mol. IUPAC name: cyclohexyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: PFQQPCBVCLVSPU-UHFFFAOYSA-N.
| Molecular formula | C14H19ClF3N |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | cyclohexyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | PFQQPCBVCLVSPU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC(=CC=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)