CAS 1803571-09-6 appears in our catalog under these names: Ethyl 3-((tert-butyldimethylsilyl)oxy)-2,2-dimethylpropanoate, Ethyl 3-((tert-butyldimethylsilyl)oxy)-2,2-dimethylpropanoate, 95%, 95%, Ethyl 3-((tert-butyldimethylsilyl)oxy)-2,2-dimethylpropanoate, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
Ethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate (CAS 1803571-09-6) is a chemical compound with the molecular formula C13H28O3Si and a molecular weight of 260.44 g/mol. IUPAC name: ethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate. InChIKey: LCGLDBLUMKVIOO-UHFFFAOYSA-N.
| Molecular formula | C13H28O3Si |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate |
| InChIKey | LCGLDBLUMKVIOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)