CAS 1803571-10-9 appears in our catalog under these names: 5-Nitro-6-(1,3-thiazol-5-yl)piperidin-2-one, 95%, 5-Nitro-6-(1,3-thiazol-5-yl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-nitro-6-(1,3-thiazol-5-yl)piperidin-2-one (CAS 1803571-10-9) is a chemical compound with the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. IUPAC name: 5-nitro-6-(1,3-thiazol-5-yl)piperidin-2-one. InChIKey: VKUDRTKQBNTQJJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 5-nitro-6-(1,3-thiazol-5-yl)piperidin-2-one |
| InChIKey | VKUDRTKQBNTQJJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(C1[N+](=O)[O-])C2=CN=CS2 |
Computed by PubChem (NCBI)